C20H24ClN3O7S2 — CID 24802815
(2S)-2-[[4-[[5-(4-chloro-3-methylsulfonylphenyl)-4-methyl-1,3-thiazol-2-yl]amino]-4-oxobutyl]amino]pentanedioic acid (PubChem CID 24802815) has the molecular formula C20H24ClN3O7S2 and a molecular weight of 518.01 g/mol. Its IUPAC name is (2S)-2-[[4-[[5-(4-chloro-3-methylsulfonylphenyl)-4-methyl-1,3-thiazol-2-yl]amino]-4-oxobutyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[[5-(4-chloro-3-methylsulfonylphenyl)-4-methyl-1,3-thiazol-2-yl]amino]-4-oxobutyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 24802815 |
| Molecular Formula | C20H24ClN3O7S2 |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | (2S)-2-[[4-[[5-(4-chloro-3-methylsulfonylphenyl)-4-methyl-1,3-thiazol-2-yl]amino]-4-oxobutyl]amino]pentanedioic acid |
| SMILES | Cc1nc(NC(=O)CCCN[C@@H](CCC(=O)O)C(=O)O)sc1-c1ccc(Cl)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H24ClN3O7S2/c1-11-18(12-5-6-13(21)15(10-12)33(2,30)31)32-20(23-11)24-16(25)4-3-9-22-14(19(28)29)7-8-17(26)27/h5-6,10,14,22H,3-4,7-9H2,1-2H3,(H,26,27)(H,28,29)(H,23,24,25)/t14-/m0/s1 |
| InChIKey | ALDDXRMKJALSSF-AWEZNQCLSA-N |
| XLogP | 2.80 |
| TPSA | 162.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|