About [(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]methanol
[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]methanol (PubChem CID 24802843) has the molecular formula C13H15Cl2NO
and a molecular weight of 272.17 g/mol. Its IUPAC name is [(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]methanol.
Molecular Properties
| Compound Name | [(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]methanol |
| PubChem CID | 24802843 |
| Molecular Formula | C13H15Cl2NO |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | [(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]methanol |
| SMILES | OC[C@@]12CNCC[C@]1(c1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C13H15Cl2NO/c14-10-2-1-9(5-11(10)15)13-3-4-16-7-12(13,6-13)8-17/h1-2,5,16-17H,3-4,6-8H2/t12-,13-/m1/s1 |
| InChIKey | RVRYTWVPEPGNKI-CHWSQXEVSA-N |
| XLogP | 2.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]methanol?
The IUPAC name of [(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]methanol (CID 24802843) is [(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]methanol.
What is the SMILES notation for [(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]methanol?
The canonical SMILES for [(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]methanol is OC[C@@]12CNCC[C@]1(c1ccc(Cl)c(Cl)c1)C2.
What is the InChIKey of [(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]methanol?
The InChIKey is RVRYTWVPEPGNKI-CHWSQXEVSA-N. The full InChI is InChI=1S/C13H15Cl2NO/c14-10-2-1-9(5-11(10)15)13-3-4-16-7-12(13,6-13)8-17/h1-2,5,16-17H,3-4,6-8H2/t12-,13-/m1/s1.
What are the key properties of [(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]methanol?
[(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]methanol has a molecular weight of 272.17 g/mol, XLogP of 2.61, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,6S)-6-(3,4-dichlorophenyl)-3-azabicyclo[4.1.0]heptan-1-yl]methanol is sourced from PubChem (CID 24802843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).