About (1R,6S)-6-(3,4-dichlorophenyl)-1-(methoxymethyl)-3-methyl-3-azabicyclo[4.1.0]heptane
(1R,6S)-6-(3,4-dichlorophenyl)-1-(methoxymethyl)-3-methyl-3-azabicyclo[4.1.0]heptane (PubChem CID 24802848) has the molecular formula C15H19Cl2NO
and a molecular weight of 300.23 g/mol. Its IUPAC name is (1R,6S)-6-(3,4-dichlorophenyl)-1-(methoxymethyl)-3-methyl-3-azabicyclo[4.1.0]heptane.
Molecular Properties
| Compound Name | (1R,6S)-6-(3,4-dichlorophenyl)-1-(methoxymethyl)-3-methyl-3-azabicyclo[4.1.0]heptane |
| PubChem CID | 24802848 |
| Molecular Formula | C15H19Cl2NO |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (1R,6S)-6-(3,4-dichlorophenyl)-1-(methoxymethyl)-3-methyl-3-azabicyclo[4.1.0]heptane |
| SMILES | COC[C@@]12CN(C)CC[C@]1(c1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C15H19Cl2NO/c1-18-6-5-15(8-14(15,9-18)10-19-2)11-3-4-12(16)13(17)7-11/h3-4,7H,5-6,8-10H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | LNWGBLPMTUFHJM-HUUCEWRRSA-N |
| XLogP | 3.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,6S)-6-(3,4-dichlorophenyl)-1-(methoxymethyl)-3-methyl-3-azabicyclo[4.1.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,6S)-6-(3,4-dichlorophenyl)-1-(methoxymethyl)-3-methyl-3-azabicyclo[4.1.0]heptane?
The IUPAC name of (1R,6S)-6-(3,4-dichlorophenyl)-1-(methoxymethyl)-3-methyl-3-azabicyclo[4.1.0]heptane (CID 24802848) is (1R,6S)-6-(3,4-dichlorophenyl)-1-(methoxymethyl)-3-methyl-3-azabicyclo[4.1.0]heptane.
What is the SMILES notation for (1R,6S)-6-(3,4-dichlorophenyl)-1-(methoxymethyl)-3-methyl-3-azabicyclo[4.1.0]heptane?
The canonical SMILES for (1R,6S)-6-(3,4-dichlorophenyl)-1-(methoxymethyl)-3-methyl-3-azabicyclo[4.1.0]heptane is COC[C@@]12CN(C)CC[C@]1(c1ccc(Cl)c(Cl)c1)C2.
What is the InChIKey of (1R,6S)-6-(3,4-dichlorophenyl)-1-(methoxymethyl)-3-methyl-3-azabicyclo[4.1.0]heptane?
The InChIKey is LNWGBLPMTUFHJM-HUUCEWRRSA-N. The full InChI is InChI=1S/C15H19Cl2NO/c1-18-6-5-15(8-14(15,9-18)10-19-2)11-3-4-12(16)13(17)7-11/h3-4,7H,5-6,8-10H2,1-2H3/t14-,15-/m1/s1.
What are the key properties of (1R,6S)-6-(3,4-dichlorophenyl)-1-(methoxymethyl)-3-methyl-3-azabicyclo[4.1.0]heptane?
(1R,6S)-6-(3,4-dichlorophenyl)-1-(methoxymethyl)-3-methyl-3-azabicyclo[4.1.0]heptane has a molecular weight of 300.23 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,6S)-6-(3,4-dichlorophenyl)-1-(methoxymethyl)-3-methyl-3-azabicyclo[4.1.0]heptane is sourced from PubChem (CID 24802848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).