C24H26ClN3O5S2 — CID 24802981
(2S)-2-[[4-[[5-(4-chloro-3-methylsulfonylphenyl)-4-methyl-1,3-thiazol-2-yl]amino]-4-oxobutyl]amino]-3-phenylpropanoic acid (PubChem CID 24802981) has the molecular formula C24H26ClN3O5S2 and a molecular weight of 536.08 g/mol. Its IUPAC name is (2S)-2-[[4-[[5-(4-chloro-3-methylsulfonylphenyl)-4-methyl-1,3-thiazol-2-yl]amino]-4-oxobutyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[4-[[5-(4-chloro-3-methylsulfonylphenyl)-4-methyl-1,3-thiazol-2-yl]amino]-4-oxobutyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 24802981 |
| Molecular Formula | C24H26ClN3O5S2 |
| Molecular Weight | 536.08 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | (2S)-2-[[4-[[5-(4-chloro-3-methylsulfonylphenyl)-4-methyl-1,3-thiazol-2-yl]amino]-4-oxobutyl]amino]-3-phenylpropanoic acid |
| SMILES | Cc1nc(NC(=O)CCCN[C@@H](Cc2ccccc2)C(=O)O)sc1-c1ccc(Cl)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C24H26ClN3O5S2/c1-15-22(17-10-11-18(25)20(14-17)35(2,32)33)34-24(27-15)28-21(29)9-6-12-26-19(23(30)31)13-16-7-4-3-5-8-16/h3-5,7-8,10-11,14,19,26H,6,9,12-13H2,1-2H3,(H,30,31)(H,27,28,29)/t19-/m0/s1 |
| InChIKey | GVRIUXAEJCIHSL-IBGZPJMESA-N |
| XLogP | 4.18 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.08 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|