C20H27ClN4O5S2 — CID 24803154
(2S)-2-[2-[[5-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-2-chlorophenyl]sulfonylamino]ethylamino]-4-methylpentanoic acid (PubChem CID 24803154) has the molecular formula C20H27ClN4O5S2 and a molecular weight of 503.05 g/mol. Its IUPAC name is (2S)-2-[2-[[5-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-2-chlorophenyl]sulfonylamino]ethylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[2-[[5-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-2-chlorophenyl]sulfonylamino]ethylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 24803154 |
| Molecular Formula | C20H27ClN4O5S2 |
| Molecular Weight | 503.05 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | (2S)-2-[2-[[5-(2-acetamido-4-methyl-1,3-thiazol-5-yl)-2-chlorophenyl]sulfonylamino]ethylamino]-4-methylpentanoic acid |
| SMILES | CC(=O)Nc1nc(C)c(-c2ccc(Cl)c(S(=O)(=O)NCCN[C@@H](CC(C)C)C(=O)O)c2)s1 |
| InChI | InChI=1S/C20H27ClN4O5S2/c1-11(2)9-16(19(27)28)22-7-8-23-32(29,30)17-10-14(5-6-15(17)21)18-12(3)24-20(31-18)25-13(4)26/h5-6,10-11,16,22-23H,7-9H2,1-4H3,(H,27,28)(H,24,25,26)/t16-/m0/s1 |
| InChIKey | CDWUKYHQWSQEHZ-INIZCTEOSA-N |
| XLogP | 3.10 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.05 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|