C37H47N9O3 — CID 24803315
N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2,2-dimethylpropanamide (PubChem CID 24803315) has the molecular formula C37H47N9O3 and a molecular weight of 665.84 g/mol. Its IUPAC name is N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 24803315 |
| Molecular Formula | C37H47N9O3 |
| Molecular Weight | 665.84 g/mol |
| Exact Mass | 665.38 |
| IUPAC Name | N-[(1S,2R,3S,4R)-4-[6-(2,2-diphenylethylamino)-2-[2-(1-propan-2-ylimidazol-4-yl)ethylamino]purin-9-yl]-2,3-dihydroxycyclopentyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)n1cnc(CCNc2nc(NCC(c3ccccc3)c3ccccc3)c3ncn([C@@H]4C[C@H](NC(=O)C(C)(C)C)[C@@H](O)[C@H]4O)c3n2)c1 |
| InChI | InChI=1S/C37H47N9O3/c1-23(2)45-20-26(40-21-45)16-17-38-36-43-33(39-19-27(24-12-8-6-9-13-24)25-14-10-7-11-15-25)30-34(44-36)46(22-41-30)29-18-28(31(47)32(29)48)42-35(49)37(3,4)5/h6-15,20-23,27-29,31-32,47-48H,16-19H2,1-5H3,(H,42,49)(H2,38,39,43,44)/t28-,29+,31+,32-/m0/s1 |
| InChIKey | UVLGOYYWYHFWSY-XPZSDMQCSA-N |
| XLogP | 4.70 |
| TPSA | 155.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.84 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |