C18H17FN4O — CID 24803338
10-[2-(dimethylamino)ethylamino]-5-fluoro-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one (PubChem CID 24803338) has the molecular formula C18H17FN4O and a molecular weight of 324.36 g/mol. Its IUPAC name is 10-[2-(dimethylamino)ethylamino]-5-fluoro-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one.
| Compound Name | 10-[2-(dimethylamino)ethylamino]-5-fluoro-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one |
|---|---|
| PubChem CID | 24803338 |
| Molecular Formula | C18H17FN4O |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 10-[2-(dimethylamino)ethylamino]-5-fluoro-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one |
| SMILES | CN(C)CCNc1ccc2ncn3c4ccc(F)cc4c(=O)c1c23 |
| InChI | InChI=1S/C18H17FN4O/c1-22(2)8-7-20-13-4-5-14-17-16(13)18(24)12-9-11(19)3-6-15(12)23(17)10-21-14/h3-6,9-10,20H,7-8H2,1-2H3 |
| InChIKey | WAIGLWXPISVSSN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|