C25H24ClN3O2S — CID 24803742
2-(4-chlorophenyl)-6-[3-methoxy-4-[(3S)-3-(methylamino)pyrrolidin-1-yl]phenyl]thieno[2,3-c]pyridin-7-one (PubChem CID 24803742) has the molecular formula C25H24ClN3O2S and a molecular weight of 466.01 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-[3-methoxy-4-[(3S)-3-(methylamino)pyrrolidin-1-yl]phenyl]thieno[2,3-c]pyridin-7-one.
| Compound Name | 2-(4-chlorophenyl)-6-[3-methoxy-4-[(3S)-3-(methylamino)pyrrolidin-1-yl]phenyl]thieno[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 24803742 |
| Molecular Formula | C25H24ClN3O2S |
| Molecular Weight | 466.01 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 2-(4-chlorophenyl)-6-[3-methoxy-4-[(3S)-3-(methylamino)pyrrolidin-1-yl]phenyl]thieno[2,3-c]pyridin-7-one |
| SMILES | CN[C@H]1CCN(c2ccc(-n3ccc4cc(-c5ccc(Cl)cc5)sc4c3=O)cc2OC)C1 |
| InChI | InChI=1S/C25H24ClN3O2S/c1-27-19-10-11-28(15-19)21-8-7-20(14-22(21)31-2)29-12-9-17-13-23(32-24(17)25(29)30)16-3-5-18(26)6-4-16/h3-9,12-14,19,27H,10-11,15H2,1-2H3/t19-/m0/s1 |
| InChIKey | QXSOSEXLDZKZSG-IBGZPJMESA-N |
| XLogP | 5.18 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.01 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|