C35H41ClN4O5 — CID 24803988
benzyl N-[5-[[5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]benzoyl]amino]pentyl]carbamate (PubChem CID 24803988) has the molecular formula C35H41ClN4O5 and a molecular weight of 633.19 g/mol. Its IUPAC name is benzyl N-[5-[[5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]benzoyl]amino]pentyl]carbamate.
| Compound Name | benzyl N-[5-[[5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]benzoyl]amino]pentyl]carbamate |
|---|---|
| PubChem CID | 24803988 |
| Molecular Formula | C35H41ClN4O5 |
| Molecular Weight | 633.19 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | benzyl N-[5-[[5-chloro-2-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethyl]piperidin-4-yl]benzoyl]amino]pentyl]carbamate |
| SMILES | O=C(NCCCCCNC(=O)c1cc(Cl)ccc1C1CCN(CCN2C(=O)COc3ccccc32)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C35H41ClN4O5/c36-28-13-14-29(27-15-19-39(20-16-27)21-22-40-31-11-5-6-12-32(31)44-25-33(40)41)30(23-28)34(42)37-17-7-2-8-18-38-35(43)45-24-26-9-3-1-4-10-26/h1,3-6,9-14,23,27H,2,7-8,15-22,24-25H2,(H,37,42)(H,38,43) |
| InChIKey | SFYVKMPZTXJXCM-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.19 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|