C11H23NO5 — CID 24804013
(3R,4R,5S,6R)-6-(ethoxymethyl)-2,4,5-trimethoxyoxan-3-amine (PubChem CID 24804013) has the molecular formula C11H23NO5 and a molecular weight of 249.31 g/mol. Its IUPAC name is (3R,4R,5S,6R)-6-(ethoxymethyl)-2,4,5-trimethoxyoxan-3-amine.
| Compound Name | (3R,4R,5S,6R)-6-(ethoxymethyl)-2,4,5-trimethoxyoxan-3-amine |
|---|---|
| PubChem CID | 24804013 |
| Molecular Formula | C11H23NO5 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | (3R,4R,5S,6R)-6-(ethoxymethyl)-2,4,5-trimethoxyoxan-3-amine |
| SMILES | CCOC[C@H]1OC(OC)[C@H](N)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C11H23NO5/c1-5-16-6-7-9(13-2)10(14-3)8(12)11(15-4)17-7/h7-11H,5-6,12H2,1-4H3/t7-,8-,9-,10-,11?/m1/s1 |
| InChIKey | YZMOSKNUHQBVKX-VZVZTSLSSA-N |
| XLogP | -0.25 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |