C12H25NO5 — CID 24804014
(3R,4R,5S,6R)-4-ethoxy-6-(ethoxymethyl)-2,5-dimethoxyoxan-3-amine (PubChem CID 24804014) has the molecular formula C12H25NO5 and a molecular weight of 263.33 g/mol. Its IUPAC name is (3R,4R,5S,6R)-4-ethoxy-6-(ethoxymethyl)-2,5-dimethoxyoxan-3-amine.
| Compound Name | (3R,4R,5S,6R)-4-ethoxy-6-(ethoxymethyl)-2,5-dimethoxyoxan-3-amine |
|---|---|
| PubChem CID | 24804014 |
| Molecular Formula | C12H25NO5 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (3R,4R,5S,6R)-4-ethoxy-6-(ethoxymethyl)-2,5-dimethoxyoxan-3-amine |
| SMILES | CCOC[C@H]1OC(OC)[C@H](N)[C@@H](OCC)[C@@H]1OC |
| InChI | InChI=1S/C12H25NO5/c1-5-16-7-8-10(14-3)11(17-6-2)9(13)12(15-4)18-8/h8-12H,5-7,13H2,1-4H3/t8-,9-,10-,11-,12?/m1/s1 |
| InChIKey | IFKNKFBXPKIWII-PRFVCTMUSA-N |
| XLogP | 0.14 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |