C14H29NO5 — CID 24804179
(3R,4R,5S,6R)-2,4,5-triethoxy-6-(ethoxymethyl)oxan-3-amine (PubChem CID 24804179) has the molecular formula C14H29NO5 and a molecular weight of 291.39 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2,4,5-triethoxy-6-(ethoxymethyl)oxan-3-amine.
| Compound Name | (3R,4R,5S,6R)-2,4,5-triethoxy-6-(ethoxymethyl)oxan-3-amine |
|---|---|
| PubChem CID | 24804179 |
| Molecular Formula | C14H29NO5 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (3R,4R,5S,6R)-2,4,5-triethoxy-6-(ethoxymethyl)oxan-3-amine |
| SMILES | CCOC[C@H]1OC(OCC)[C@H](N)[C@@H](OCC)[C@@H]1OCC |
| InChI | InChI=1S/C14H29NO5/c1-5-16-9-10-12(17-6-2)13(18-7-3)11(15)14(20-10)19-8-4/h10-14H,5-9,15H2,1-4H3/t10-,11-,12-,13-,14?/m1/s1 |
| InChIKey | YLKCYKRPWMJBQB-GNMOMJPPSA-N |
| XLogP | 0.92 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |