About 7-tert-butylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine
7-tert-butylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine (PubChem CID 24804627) has the molecular formula C16H23NO
and a molecular weight of 245.37 g/mol. Its IUPAC name is 7-tert-butylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine.
Molecular Properties
| Compound Name | 7-tert-butylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine |
| PubChem CID | 24804627 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 7-tert-butylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine |
| SMILES | CC(C)(C)c1ccc2c(c1)OC1(CCC1)CC2N |
| InChI | InChI=1S/C16H23NO/c1-15(2,3)11-5-6-12-13(17)10-16(7-4-8-16)18-14(12)9-11/h5-6,9,13H,4,7-8,10,17H2,1-3H3 |
| InChIKey | IYHKYAPBWISJMN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-tert-butylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine?
The IUPAC name of 7-tert-butylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine (CID 24804627) is 7-tert-butylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine.
What is the SMILES notation for 7-tert-butylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine?
The canonical SMILES for 7-tert-butylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine is CC(C)(C)c1ccc2c(c1)OC1(CCC1)CC2N.
What is the InChIKey of 7-tert-butylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine?
The InChIKey is IYHKYAPBWISJMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO/c1-15(2,3)11-5-6-12-13(17)10-16(7-4-8-16)18-14(12)9-11/h5-6,9,13H,4,7-8,10,17H2,1-3H3.
What are the key properties of 7-tert-butylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine?
7-tert-butylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine has a molecular weight of 245.37 g/mol, XLogP of 3.69, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine is sourced from PubChem (CID 24804627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).