C16H20N4O2 — CID 24804699
3-ethyl-12-methoxy-5-methyl-7-propoxy-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 24804699) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-ethyl-12-methoxy-5-methyl-7-propoxy-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 3-ethyl-12-methoxy-5-methyl-7-propoxy-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 24804699 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 3-ethyl-12-methoxy-5-methyl-7-propoxy-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | CCCOc1nc2ccc(OC)nc2n2c(CC)nc(C)c12 |
| InChI | InChI=1S/C16H20N4O2/c1-5-9-22-16-14-10(3)17-12(6-2)20(14)15-11(18-16)7-8-13(19-15)21-4/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | QGUUMNJEMZDEGS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |