C28H31FN4O — CID 24804943
5-[2-[(2S)-4-(7-fluoro-2-methylquinolin-5-yl)-2-methylpiperazin-1-yl]ethyl]-1,6-dimethylquinolin-2-one (PubChem CID 24804943) has the molecular formula C28H31FN4O and a molecular weight of 458.58 g/mol. Its IUPAC name is 5-[2-[(2S)-4-(7-fluoro-2-methylquinolin-5-yl)-2-methylpiperazin-1-yl]ethyl]-1,6-dimethylquinolin-2-one.
| Compound Name | 5-[2-[(2S)-4-(7-fluoro-2-methylquinolin-5-yl)-2-methylpiperazin-1-yl]ethyl]-1,6-dimethylquinolin-2-one |
|---|---|
| PubChem CID | 24804943 |
| Molecular Formula | C28H31FN4O |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 5-[2-[(2S)-4-(7-fluoro-2-methylquinolin-5-yl)-2-methylpiperazin-1-yl]ethyl]-1,6-dimethylquinolin-2-one |
| SMILES | Cc1ccc2c(N3CCN(CCc4c(C)ccc5c4ccc(=O)n5C)[C@@H](C)C3)cc(F)cc2n1 |
| InChI | InChI=1S/C28H31FN4O/c1-18-5-9-26-23(8-10-28(34)31(26)4)22(18)11-12-32-13-14-33(17-20(32)3)27-16-21(29)15-25-24(27)7-6-19(2)30-25/h5-10,15-16,20H,11-14,17H2,1-4H3/t20-/m0/s1 |
| InChIKey | XBOCLCGHZJWWCY-FQEVSTJZSA-N |
| XLogP | 4.60 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|