C15H12FN5O3 — CID 24805139
N-[2-fluoro-5-(3-nitropyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-methylacetamide (PubChem CID 24805139) has the molecular formula C15H12FN5O3 and a molecular weight of 329.29 g/mol. Its IUPAC name is N-[2-fluoro-5-(3-nitropyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-methylacetamide.
| Compound Name | N-[2-fluoro-5-(3-nitropyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 24805139 |
| Molecular Formula | C15H12FN5O3 |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-[2-fluoro-5-(3-nitropyrazolo[1,5-a]pyrimidin-7-yl)phenyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)c1cc(-c2ccnc3c([N+](=O)[O-])cnn23)ccc1F |
| InChI | InChI=1S/C15H12FN5O3/c1-9(22)19(2)13-7-10(3-4-11(13)16)12-5-6-17-15-14(21(23)24)8-18-20(12)15/h3-8H,1-2H3 |
| InChIKey | TZVOGZXCZOYXSH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|