About CID 24805318
CID 24805318 (PubChem CID 24805318) has the molecular formula C31H38Cl2N2RuS
and a molecular weight of 642.70 g/mol.
Molecular Properties
| Compound Name | CID 24805318 |
| PubChem CID | 24805318 |
| Molecular Formula | C31H38Cl2N2RuS |
| Molecular Weight | 642.70 g/mol |
| Exact Mass | 642.12 |
| IUPAC Name | — |
| SMILES | CC(C)Sc1ccccc1C=[Ru](Cl)Cl.Cc1cc(C)c(N2[C]N(c3c(C)cc(C)cc3C)CC2)c(C)c1 |
| InChI | InChI=1S/C21H26N2.C10H12S.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-8(2)11-10-7-5-4-6-9(10)3;;;/h9-12H,7-8H2,1-6H3;3-8H,1-2H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | BZUNBACDKJPQSR-UHFFFAOYSA-L |
| XLogP | 9.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 642.70 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 24805318 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24805318?
The IUPAC name of CID 24805318 (CID 24805318) is not available.
What is the SMILES notation for CID 24805318?
The canonical SMILES for CID 24805318 is CC(C)Sc1ccccc1C=[Ru](Cl)Cl.Cc1cc(C)c(N2[C]N(c3c(C)cc(C)cc3C)CC2)c(C)c1.
What is the InChIKey of CID 24805318?
The InChIKey is BZUNBACDKJPQSR-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H26N2.C10H12S.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-8(2)11-10-7-5-4-6-9(10)3;;;/h9-12H,7-8H2,1-6H3;3-8H,1-2H3;2*1H;/q;;;;+2/p-2.
What are the key properties of CID 24805318?
CID 24805318 has a molecular weight of 642.70 g/mol, XLogP of 9.12, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24805318 is sourced from PubChem (CID 24805318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).