C25H29N6O7PS — CID 24805351
5-(dimethylamino)-N-[[1-[2-[ethoxy-(4-nitrophenoxy)phosphoryl]ethyl]triazol-4-yl]methyl]naphthalene-1-sulfonamide (PubChem CID 24805351) has the molecular formula C25H29N6O7PS and a molecular weight of 588.58 g/mol. Its IUPAC name is 5-(dimethylamino)-N-[[1-[2-[ethoxy-(4-nitrophenoxy)phosphoryl]ethyl]triazol-4-yl]methyl]naphthalene-1-sulfonamide.
| Compound Name | 5-(dimethylamino)-N-[[1-[2-[ethoxy-(4-nitrophenoxy)phosphoryl]ethyl]triazol-4-yl]methyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 24805351 |
| Molecular Formula | C25H29N6O7PS |
| Molecular Weight | 588.58 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | 5-(dimethylamino)-N-[[1-[2-[ethoxy-(4-nitrophenoxy)phosphoryl]ethyl]triazol-4-yl]methyl]naphthalene-1-sulfonamide |
| SMILES | CCOP(=O)(CCn1cc(CNS(=O)(=O)c2cccc3c(N(C)C)cccc23)nn1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H29N6O7PS/c1-4-37-39(34,38-21-13-11-20(12-14-21)31(32)33)16-15-30-18-19(27-28-30)17-26-40(35,36)25-10-6-7-22-23(25)8-5-9-24(22)29(2)3/h5-14,18,26H,4,15-17H2,1-3H3 |
| InChIKey | QLSIWCQVMZXPDT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 158.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|