C17H23NO4 — CID 24805376
N-[(1S)-1-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]-1-phenylmethanimine oxide (PubChem CID 24805376) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is N-[(1S)-1-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]-1-phenylmethanimine oxide.
| Compound Name | N-[(1S)-1-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]-1-phenylmethanimine oxide |
|---|---|
| PubChem CID | 24805376 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | N-[(1S)-1-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]-1-phenylmethanimine oxide |
| SMILES | C=CC[C@@H]([C@@H]1OC(C)(C)O[C@@H]1CO)/[N+]([O-])=C/c1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c1-4-8-14(16-15(12-19)21-17(2,3)22-16)18(20)11-13-9-6-5-7-10-13/h4-7,9-11,14-16,19H,1,8,12H2,2-3H3/b18-11-/t14-,15+,16-/m0/s1 |
| InChIKey | SVTOVPARFGNHSC-RYAKIJTLSA-N |
| XLogP | 2.07 |
| TPSA | 64.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|