C22H24O5 — CID 24805863
17-methyl-6,10-dipropyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),5,8(13),11-pentaene-4,18-dione (PubChem CID 24805863) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is 17-methyl-6,10-dipropyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),5,8(13),11-pentaene-4,18-dione.
| Compound Name | 17-methyl-6,10-dipropyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),5,8(13),11-pentaene-4,18-dione |
|---|---|
| PubChem CID | 24805863 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 17-methyl-6,10-dipropyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),5,8(13),11-pentaene-4,18-dione |
| SMILES | CCCc1cc(=O)oc2c3c(c4c(c12)OC(CCC)C=C4)OCC(C)C3=O |
| InChI | InChI=1S/C22H24O5/c1-4-6-13-10-16(23)27-22-17(13)21-15(9-8-14(26-21)7-5-2)20-18(22)19(24)12(3)11-25-20/h8-10,12,14H,4-7,11H2,1-3H3 |
| InChIKey | AVWJHYIKAVINDW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|