About 2-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-2,6-diamine
2-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-2,6-diamine (PubChem CID 24805875) has the molecular formula C24H31N5O
and a molecular weight of 405.55 g/mol. Its IUPAC name is 2-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-2,6-diamine.
Molecular Properties
| Compound Name | 2-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-2,6-diamine |
| PubChem CID | 24805875 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 2-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-2,6-diamine |
| SMILES | COc1ccccc1N1CCN(CCCCNc2ccc3cc(N)ccc3n2)CC1 |
| InChI | InChI=1S/C24H31N5O/c1-30-23-7-3-2-6-22(23)29-16-14-28(15-17-29)13-5-4-12-26-24-11-8-19-18-20(25)9-10-21(19)27-24/h2-3,6-11,18H,4-5,12-17,25H2,1H3,(H,26,27) |
| InChIKey | MTXXOEHYWJHPTL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-2,6-diamine?
The IUPAC name of 2-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-2,6-diamine (CID 24805875) is 2-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-2,6-diamine.
What is the SMILES notation for 2-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-2,6-diamine?
The canonical SMILES for 2-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-2,6-diamine is COc1ccccc1N1CCN(CCCCNc2ccc3cc(N)ccc3n2)CC1.
What is the InChIKey of 2-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-2,6-diamine?
The InChIKey is MTXXOEHYWJHPTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31N5O/c1-30-23-7-3-2-6-22(23)29-16-14-28(15-17-29)13-5-4-12-26-24-11-8-19-18-20(25)9-10-21(19)27-24/h2-3,6-11,18H,4-5,12-17,25H2,1H3,(H,26,27).
What are the key properties of 2-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-2,6-diamine?
2-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-2,6-diamine has a molecular weight of 405.55 g/mol, XLogP of 3.84, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]quinoline-2,6-diamine is sourced from PubChem (CID 24805875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).