C22H22N4O2 — CID 24806046
N-[(E)-[4-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]-[1,3]dioxolo[4,5-g]quinolin-8-amine (PubChem CID 24806046) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-[(E)-[4-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]-[1,3]dioxolo[4,5-g]quinolin-8-amine.
| Compound Name | N-[(E)-[4-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]-[1,3]dioxolo[4,5-g]quinolin-8-amine |
|---|---|
| PubChem CID | 24806046 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-[(E)-[4-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]-[1,3]dioxolo[4,5-g]quinolin-8-amine |
| SMILES | C(=N/Nc1ccnc2cc3c(cc12)OCO3)\c1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C22H22N4O2/c1-2-10-26(9-1)14-17-5-3-16(4-6-17)13-24-25-19-7-8-23-20-12-22-21(11-18(19)20)27-15-28-22/h3-8,11-13H,1-2,9-10,14-15H2,(H,23,25)/b24-13+ |
| InChIKey | GAVWWSJSCYNUIW-ZMOGYAJESA-N |
| XLogP | 4.01 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|