C29H54O5Si2 — CID 24806080
(4R,6R)-4-methoxy-6-[(1R,2E,4E,6R,8Z)-6-methoxy-3-methyl-9-trimethylsilyl-1-tri(propan-2-yl)silyloxynona-2,4,8-trienyl]oxan-2-one (PubChem CID 24806080) has the molecular formula C29H54O5Si2 and a molecular weight of 538.92 g/mol. Its IUPAC name is (4R,6R)-4-methoxy-6-[(1R,2E,4E,6R,8Z)-6-methoxy-3-methyl-9-trimethylsilyl-1-tri(propan-2-yl)silyloxynona-2,4,8-trienyl]oxan-2-one.
| Compound Name | (4R,6R)-4-methoxy-6-[(1R,2E,4E,6R,8Z)-6-methoxy-3-methyl-9-trimethylsilyl-1-tri(propan-2-yl)silyloxynona-2,4,8-trienyl]oxan-2-one |
|---|---|
| PubChem CID | 24806080 |
| Molecular Formula | C29H54O5Si2 |
| Molecular Weight | 538.92 g/mol |
| Exact Mass | 538.35 |
| IUPAC Name | (4R,6R)-4-methoxy-6-[(1R,2E,4E,6R,8Z)-6-methoxy-3-methyl-9-trimethylsilyl-1-tri(propan-2-yl)silyloxynona-2,4,8-trienyl]oxan-2-one |
| SMILES | CO[C@H]1CC(=O)O[C@@H]([C@@H](/C=C(C)/C=C/[C@@H](C/C=C\[Si](C)(C)C)OC)O[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C29H54O5Si2/c1-21(2)36(22(3)4,23(5)6)34-28(27-19-26(32-9)20-29(30)33-27)18-24(7)15-16-25(31-8)14-13-17-35(10,11)12/h13,15-18,21-23,25-28H,14,19-20H2,1-12H3/b16-15+,17-13-,24-18+/t25-,26-,27-,28-/m1/s1 |
| InChIKey | JZLIJGBGOZVYAP-KOLCDGIUSA-N |
| XLogP | 7.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.92 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|