About (2R)-2-amino-3-(1,1-diphenylpropylsulfanyl)propanoic acid
(2R)-2-amino-3-(1,1-diphenylpropylsulfanyl)propanoic acid (PubChem CID 24806224) has the molecular formula C18H21NO2S
and a molecular weight of 315.44 g/mol. Its IUPAC name is (2R)-2-amino-3-(1,1-diphenylpropylsulfanyl)propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-amino-3-(1,1-diphenylpropylsulfanyl)propanoic acid |
| PubChem CID | 24806224 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (2R)-2-amino-3-(1,1-diphenylpropylsulfanyl)propanoic acid |
| SMILES | CCC(SC[C@H](N)C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO2S/c1-2-18(14-9-5-3-6-10-14,15-11-7-4-8-12-15)22-13-16(19)17(20)21/h3-12,16H,2,13,19H2,1H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | FQQGOQUGLYTNND-INIZCTEOSA-N |
| XLogP | 3.49 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-amino-3-(1,1-diphenylpropylsulfanyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3-(1,1-diphenylpropylsulfanyl)propanoic acid?
The IUPAC name of (2R)-2-amino-3-(1,1-diphenylpropylsulfanyl)propanoic acid (CID 24806224) is (2R)-2-amino-3-(1,1-diphenylpropylsulfanyl)propanoic acid.
What is the SMILES notation for (2R)-2-amino-3-(1,1-diphenylpropylsulfanyl)propanoic acid?
The canonical SMILES for (2R)-2-amino-3-(1,1-diphenylpropylsulfanyl)propanoic acid is CCC(SC[C@H](N)C(=O)O)(c1ccccc1)c1ccccc1.
What is the InChIKey of (2R)-2-amino-3-(1,1-diphenylpropylsulfanyl)propanoic acid?
The InChIKey is FQQGOQUGLYTNND-INIZCTEOSA-N. The full InChI is InChI=1S/C18H21NO2S/c1-2-18(14-9-5-3-6-10-14,15-11-7-4-8-12-15)22-13-16(19)17(20)21/h3-12,16H,2,13,19H2,1H3,(H,20,21)/t16-/m0/s1.
What are the key properties of (2R)-2-amino-3-(1,1-diphenylpropylsulfanyl)propanoic acid?
(2R)-2-amino-3-(1,1-diphenylpropylsulfanyl)propanoic acid has a molecular weight of 315.44 g/mol, XLogP of 3.49, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-(1,1-diphenylpropylsulfanyl)propanoic acid is sourced from PubChem (CID 24806224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).