About 8-bromo-1-(3,4-difluorophenyl)-1,2-dihydrobenzo[f]chromen-3-one
8-bromo-1-(3,4-difluorophenyl)-1,2-dihydrobenzo[f]chromen-3-one (PubChem CID 24806236) has the molecular formula C19H11BrF2O2
and a molecular weight of 389.20 g/mol. Its IUPAC name is 8-bromo-1-(3,4-difluorophenyl)-1,2-dihydrobenzo[f]chromen-3-one.
Molecular Properties
| Compound Name | 8-bromo-1-(3,4-difluorophenyl)-1,2-dihydrobenzo[f]chromen-3-one |
| PubChem CID | 24806236 |
| Molecular Formula | C19H11BrF2O2 |
| Molecular Weight | 389.20 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | 8-bromo-1-(3,4-difluorophenyl)-1,2-dihydrobenzo[f]chromen-3-one |
| SMILES | O=C1CC(c2ccc(F)c(F)c2)c2c(ccc3cc(Br)ccc23)O1 |
| InChI | InChI=1S/C19H11BrF2O2/c20-12-3-4-13-10(7-12)2-6-17-19(13)14(9-18(23)24-17)11-1-5-15(21)16(22)8-11/h1-8,14H,9H2 |
| InChIKey | MNFPVGPCPUSMGV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.20 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-1-(3,4-difluorophenyl)-1,2-dihydrobenzo[f]chromen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-1-(3,4-difluorophenyl)-1,2-dihydrobenzo[f]chromen-3-one?
The IUPAC name of 8-bromo-1-(3,4-difluorophenyl)-1,2-dihydrobenzo[f]chromen-3-one (CID 24806236) is 8-bromo-1-(3,4-difluorophenyl)-1,2-dihydrobenzo[f]chromen-3-one.
What is the SMILES notation for 8-bromo-1-(3,4-difluorophenyl)-1,2-dihydrobenzo[f]chromen-3-one?
The canonical SMILES for 8-bromo-1-(3,4-difluorophenyl)-1,2-dihydrobenzo[f]chromen-3-one is O=C1CC(c2ccc(F)c(F)c2)c2c(ccc3cc(Br)ccc23)O1.
What is the InChIKey of 8-bromo-1-(3,4-difluorophenyl)-1,2-dihydrobenzo[f]chromen-3-one?
The InChIKey is MNFPVGPCPUSMGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11BrF2O2/c20-12-3-4-13-10(7-12)2-6-17-19(13)14(9-18(23)24-17)11-1-5-15(21)16(22)8-11/h1-8,14H,9H2.
What are the key properties of 8-bromo-1-(3,4-difluorophenyl)-1,2-dihydrobenzo[f]chromen-3-one?
8-bromo-1-(3,4-difluorophenyl)-1,2-dihydrobenzo[f]chromen-3-one has a molecular weight of 389.20 g/mol, XLogP of 5.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-1-(3,4-difluorophenyl)-1,2-dihydrobenzo[f]chromen-3-one is sourced from PubChem (CID 24806236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).