About N-nonyl-3-phenylaniline
N-nonyl-3-phenylaniline (PubChem CID 24806279) has the molecular formula C21H29N
and a molecular weight of 295.47 g/mol. Its IUPAC name is N-nonyl-3-phenylaniline.
Molecular Properties
| Compound Name | N-nonyl-3-phenylaniline |
| PubChem CID | 24806279 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | N-nonyl-3-phenylaniline |
| SMILES | CCCCCCCCCNc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H29N/c1-2-3-4-5-6-7-11-17-22-21-16-12-15-20(18-21)19-13-9-8-10-14-19/h8-10,12-16,18,22H,2-7,11,17H2,1H3 |
| InChIKey | JUSKNUJWBCEVLC-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-nonyl-3-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-nonyl-3-phenylaniline?
The IUPAC name of N-nonyl-3-phenylaniline (CID 24806279) is N-nonyl-3-phenylaniline.
What is the SMILES notation for N-nonyl-3-phenylaniline?
The canonical SMILES for N-nonyl-3-phenylaniline is CCCCCCCCCNc1cccc(-c2ccccc2)c1.
What is the InChIKey of N-nonyl-3-phenylaniline?
The InChIKey is JUSKNUJWBCEVLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N/c1-2-3-4-5-6-7-11-17-22-21-16-12-15-20(18-21)19-13-9-8-10-14-19/h8-10,12-16,18,22H,2-7,11,17H2,1H3.
What are the key properties of N-nonyl-3-phenylaniline?
N-nonyl-3-phenylaniline has a molecular weight of 295.47 g/mol, XLogP of 6.52, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-nonyl-3-phenylaniline is sourced from PubChem (CID 24806279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).