C26H45BrO5Si — CID 24806488
(4R,6R)-6-[(1R,2E,4E,6R,8Z)-9-bromo-6-methoxy-3-methyl-1-tri(propan-2-yl)silyloxynona-2,4,8-trienyl]-4-methoxyoxan-2-one (PubChem CID 24806488) has the molecular formula C26H45BrO5Si and a molecular weight of 545.63 g/mol. Its IUPAC name is (4R,6R)-6-[(1R,2E,4E,6R,8Z)-9-bromo-6-methoxy-3-methyl-1-tri(propan-2-yl)silyloxynona-2,4,8-trienyl]-4-methoxyoxan-2-one.
| Compound Name | (4R,6R)-6-[(1R,2E,4E,6R,8Z)-9-bromo-6-methoxy-3-methyl-1-tri(propan-2-yl)silyloxynona-2,4,8-trienyl]-4-methoxyoxan-2-one |
|---|---|
| PubChem CID | 24806488 |
| Molecular Formula | C26H45BrO5Si |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | (4R,6R)-6-[(1R,2E,4E,6R,8Z)-9-bromo-6-methoxy-3-methyl-1-tri(propan-2-yl)silyloxynona-2,4,8-trienyl]-4-methoxyoxan-2-one |
| SMILES | CO[C@H]1CC(=O)O[C@@H]([C@@H](/C=C(C)/C=C/[C@@H](C/C=C\Br)OC)O[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C26H45BrO5Si/c1-18(2)33(19(3)4,20(5)6)32-25(24-16-23(30-9)17-26(28)31-24)15-21(7)12-13-22(29-8)11-10-14-27/h10,12-15,18-20,22-25H,11,16-17H2,1-9H3/b13-12+,14-10-,21-15+/t22-,23-,24-,25-/m1/s1 |
| InChIKey | MOKWPIBZFGXVBS-NSMXEPGKSA-N |
| XLogP | 7.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|