C27H22Cl2O3 — CID 24806758
cis-[1-(2-methoxynaphthalen-1-yl)naphthalen-2-yl] (1R,3R)-2,2-dichloro-1,3-dimethylcyclopropane-1-carboxylate (PubChem CID 24806758) has the molecular formula C27H22Cl2O3 and a molecular weight of 465.38 g/mol. Its IUPAC name is cis-[1-(2-methoxynaphthalen-1-yl)naphthalen-2-yl] (1R,3R)-2,2-dichloro-1,3-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-[1-(2-methoxynaphthalen-1-yl)naphthalen-2-yl] (1R,3R)-2,2-dichloro-1,3-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 24806758 |
| Molecular Formula | C27H22Cl2O3 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | cis-[1-(2-methoxynaphthalen-1-yl)naphthalen-2-yl] (1R,3R)-2,2-dichloro-1,3-dimethylcyclopropane-1-carboxylate |
| SMILES | COc1ccc2ccccc2c1-c1c(OC(=O)[C@@]2(C)[C@@H](C)C2(Cl)Cl)ccc2ccccc12 |
| InChI | InChI=1S/C27H22Cl2O3/c1-16-26(2,27(16,28)29)25(30)32-22-15-13-18-9-5-7-11-20(18)24(22)23-19-10-6-4-8-17(19)12-14-21(23)31-3/h4-16H,1-3H3/t16-,26-/m1/s1 |
| InChIKey | WPYHUDPICIFOLS-AKJBCIBTSA-N |
| XLogP | 7.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|