C33H28O4 — CID 24806928
ethyl (2R,4S,5R)-4-benzyl-2,5-dinaphthalen-2-yl-1,3-dioxolane-4-carboxylate (PubChem CID 24806928) has the molecular formula C33H28O4 and a molecular weight of 488.58 g/mol. Its IUPAC name is ethyl (2R,4S,5R)-4-benzyl-2,5-dinaphthalen-2-yl-1,3-dioxolane-4-carboxylate.
| Compound Name | ethyl (2R,4S,5R)-4-benzyl-2,5-dinaphthalen-2-yl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 24806928 |
| Molecular Formula | C33H28O4 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | ethyl (2R,4S,5R)-4-benzyl-2,5-dinaphthalen-2-yl-1,3-dioxolane-4-carboxylate |
| SMILES | CCOC(=O)[C@@]1(Cc2ccccc2)O[C@H](c2ccc3ccccc3c2)O[C@@H]1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C33H28O4/c1-2-35-32(34)33(22-23-10-4-3-5-11-23)30(28-18-16-24-12-6-8-14-26(24)20-28)36-31(37-33)29-19-17-25-13-7-9-15-27(25)21-29/h3-21,30-31H,2,22H2,1H3/t30-,31-,33+/m1/s1 |
| InChIKey | VEAKZTRBJXOZIU-IZWPZILSSA-N |
| XLogP | 7.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |