About [2-(3-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate
[2-(3-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate (PubChem CID 2480700) has the molecular formula C15H18FNO3
and a molecular weight of 279.31 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate.
Molecular Properties
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate |
| PubChem CID | 2480700 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate |
| SMILES | O=C(COC(=O)CC1CCCC1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C15H18FNO3/c16-12-6-3-7-13(9-12)17-14(18)10-20-15(19)8-11-4-1-2-5-11/h3,6-7,9,11H,1-2,4-5,8,10H2,(H,17,18) |
| InChIKey | YSOSAUWESKMKIG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(3-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate?
The IUPAC name of [2-(3-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate (CID 2480700) is [2-(3-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate.
What is the SMILES notation for [2-(3-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate?
The canonical SMILES for [2-(3-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate is O=C(COC(=O)CC1CCCC1)Nc1cccc(F)c1.
What is the InChIKey of [2-(3-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate?
The InChIKey is YSOSAUWESKMKIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18FNO3/c16-12-6-3-7-13(9-12)17-14(18)10-20-15(19)8-11-4-1-2-5-11/h3,6-7,9,11H,1-2,4-5,8,10H2,(H,17,18).
What are the key properties of [2-(3-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate?
[2-(3-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate has a molecular weight of 279.31 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-fluoroanilino)-2-oxoethyl] 2-cyclopentylacetate is sourced from PubChem (CID 2480700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).