C23H44O4Si — CID 24807199
[(3R,4R)-4-methylhex-5-en-3-yl] (2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-oxoheptanoate (PubChem CID 24807199) has the molecular formula C23H44O4Si and a molecular weight of 412.69 g/mol. Its IUPAC name is [(3R,4R)-4-methylhex-5-en-3-yl] (2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-oxoheptanoate.
| Compound Name | [(3R,4R)-4-methylhex-5-en-3-yl] (2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-oxoheptanoate |
|---|---|
| PubChem CID | 24807199 |
| Molecular Formula | C23H44O4Si |
| Molecular Weight | 412.69 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | [(3R,4R)-4-methylhex-5-en-3-yl] (2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-oxoheptanoate |
| SMILES | C=C[C@@H](C)[C@@H](CC)OC(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@@H](C)C=O |
| InChI | InChI=1S/C23H44O4Si/c1-12-17(4)20(13-2)26-22(25)19(6)21(18(5)14-16(3)15-24)27-28(10,11)23(7,8)9/h12,15-21H,1,13-14H2,2-11H3/t16-,17-,18+,19-,20-,21+/m1/s1 |
| InChIKey | LVJPQXFWZRIXBD-RZTRGMPVSA-N |
| XLogP | 6.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.69 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|