C20H16Cl2FN5 — CID 24807252
1-[2-chloro-2-(4-fluorophenyl)ethyl]-N-[(3-chlorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 24807252) has the molecular formula C20H16Cl2FN5 and a molecular weight of 416.29 g/mol. Its IUPAC name is 1-[2-chloro-2-(4-fluorophenyl)ethyl]-N-[(3-chlorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-[2-chloro-2-(4-fluorophenyl)ethyl]-N-[(3-chlorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 24807252 |
| Molecular Formula | C20H16Cl2FN5 |
| Molecular Weight | 416.29 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 1-[2-chloro-2-(4-fluorophenyl)ethyl]-N-[(3-chlorophenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Fc1ccc(C(Cl)Cn2ncc3c(NCc4cccc(Cl)c4)ncnc32)cc1 |
| InChI | InChI=1S/C20H16Cl2FN5/c21-15-3-1-2-13(8-15)9-24-19-17-10-27-28(20(17)26-12-25-19)11-18(22)14-4-6-16(23)7-5-14/h1-8,10,12,18H,9,11H2,(H,24,25,26) |
| InChIKey | XUDKYQHQWBZMRI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.29 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|