C21H38O2Si2 — CID 24807342
(4R,6S)-3-ethenylidene-2,2-diethyl-6-[2-tri(propan-2-yl)silylethynyl]oxasilinan-4-ol (PubChem CID 24807342) has the molecular formula C21H38O2Si2 and a molecular weight of 378.71 g/mol. Its IUPAC name is (4R,6S)-3-ethenylidene-2,2-diethyl-6-[2-tri(propan-2-yl)silylethynyl]oxasilinan-4-ol.
| Compound Name | (4R,6S)-3-ethenylidene-2,2-diethyl-6-[2-tri(propan-2-yl)silylethynyl]oxasilinan-4-ol |
|---|---|
| PubChem CID | 24807342 |
| Molecular Formula | C21H38O2Si2 |
| Molecular Weight | 378.71 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (4R,6S)-3-ethenylidene-2,2-diethyl-6-[2-tri(propan-2-yl)silylethynyl]oxasilinan-4-ol |
| SMILES | C=C=C1[C@H](O)C[C@@H](C#C[Si](C(C)C)(C(C)C)C(C)C)O[Si]1(CC)CC |
| InChI | InChI=1S/C21H38O2Si2/c1-10-21-20(22)15-19(23-24(21,11-2)12-3)13-14-25(16(4)5,17(6)7)18(8)9/h16-20,22H,1,11-12,15H2,2-9H3/t19-,20-/m1/s1 |
| InChIKey | HDANBKWFPKUJPI-WOJBJXKFSA-N |
| XLogP | 5.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.71 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|