C21H21NO4 — CID 24807597
methyl (2R,3S,3aS,6aR)-1-benzyl-6-oxo-2-phenyl-3,3a,4,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3-carboxylate (PubChem CID 24807597) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is methyl (2R,3S,3aS,6aR)-1-benzyl-6-oxo-2-phenyl-3,3a,4,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3-carboxylate.
| Compound Name | methyl (2R,3S,3aS,6aR)-1-benzyl-6-oxo-2-phenyl-3,3a,4,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 24807597 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | methyl (2R,3S,3aS,6aR)-1-benzyl-6-oxo-2-phenyl-3,3a,4,6a-tetrahydro-2H-furo[3,4-b]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]2COC(=O)[C@@H]2N(Cc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H21NO4/c1-25-20(23)17-16-13-26-21(24)19(16)22(12-14-8-4-2-5-9-14)18(17)15-10-6-3-7-11-15/h2-11,16-19H,12-13H2,1H3/t16-,17-,18-,19+/m0/s1 |
| InChIKey | KAJBIFJVJZWLIS-CADBVGFASA-N |
| XLogP | 2.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |