C22H23NO5 — CID 24807599
1-O-benzyl 3-O-methyl (2R,3S,3aS,6aR)-2-phenyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1,3-dicarboxylate (PubChem CID 24807599) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-O-benzyl 3-O-methyl (2R,3S,3aS,6aR)-2-phenyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-methyl (2R,3S,3aS,6aR)-2-phenyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 24807599 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1-O-benzyl 3-O-methyl (2R,3S,3aS,6aR)-2-phenyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]2COC[C@@H]2N(C(=O)OCc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H23NO5/c1-26-21(24)19-17-13-27-14-18(17)23(20(19)16-10-6-3-7-11-16)22(25)28-12-15-8-4-2-5-9-15/h2-11,17-20H,12-14H2,1H3/t17-,18+,19+,20+/m1/s1 |
| InChIKey | SYIRJJMCWWWYDA-FYQPLNBISA-N |
| XLogP | 3.18 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |