About triethyl (E)-7-cyclopropyl-5-methylhept-6-en-1-yne-1,4,4-tricarboxylate
triethyl (E)-7-cyclopropyl-5-methylhept-6-en-1-yne-1,4,4-tricarboxylate (PubChem CID 24808271) has the molecular formula C20H28O6
and a molecular weight of 364.44 g/mol. Its IUPAC name is triethyl (E)-7-cyclopropyl-5-methylhept-6-en-1-yne-1,4,4-tricarboxylate.
Molecular Properties
| Compound Name | triethyl (E)-7-cyclopropyl-5-methylhept-6-en-1-yne-1,4,4-tricarboxylate |
| PubChem CID | 24808271 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | triethyl (E)-7-cyclopropyl-5-methylhept-6-en-1-yne-1,4,4-tricarboxylate |
| SMILES | CCOC(=O)C#CCC(C(=O)OCC)(C(=O)OCC)C(C)/C=C/C1CC1 |
| InChI | InChI=1S/C20H28O6/c1-5-24-17(21)9-8-14-20(18(22)25-6-2,19(23)26-7-3)15(4)10-11-16-12-13-16/h10-11,15-16H,5-7,12-14H2,1-4H3/b11-10+ |
| InChIKey | MUXNWEMVGJPDHX-ZHACJKMWSA-N |
| XLogP | 2.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze triethyl (E)-7-cyclopropyl-5-methylhept-6-en-1-yne-1,4,4-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl (E)-7-cyclopropyl-5-methylhept-6-en-1-yne-1,4,4-tricarboxylate?
The IUPAC name of triethyl (E)-7-cyclopropyl-5-methylhept-6-en-1-yne-1,4,4-tricarboxylate (CID 24808271) is triethyl (E)-7-cyclopropyl-5-methylhept-6-en-1-yne-1,4,4-tricarboxylate.
What is the SMILES notation for triethyl (E)-7-cyclopropyl-5-methylhept-6-en-1-yne-1,4,4-tricarboxylate?
The canonical SMILES for triethyl (E)-7-cyclopropyl-5-methylhept-6-en-1-yne-1,4,4-tricarboxylate is CCOC(=O)C#CCC(C(=O)OCC)(C(=O)OCC)C(C)/C=C/C1CC1.
What is the InChIKey of triethyl (E)-7-cyclopropyl-5-methylhept-6-en-1-yne-1,4,4-tricarboxylate?
The InChIKey is MUXNWEMVGJPDHX-ZHACJKMWSA-N. The full InChI is InChI=1S/C20H28O6/c1-5-24-17(21)9-8-14-20(18(22)25-6-2,19(23)26-7-3)15(4)10-11-16-12-13-16/h10-11,15-16H,5-7,12-14H2,1-4H3/b11-10+.
What are the key properties of triethyl (E)-7-cyclopropyl-5-methylhept-6-en-1-yne-1,4,4-tricarboxylate?
triethyl (E)-7-cyclopropyl-5-methylhept-6-en-1-yne-1,4,4-tricarboxylate has a molecular weight of 364.44 g/mol, XLogP of 2.66, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl (E)-7-cyclopropyl-5-methylhept-6-en-1-yne-1,4,4-tricarboxylate is sourced from PubChem (CID 24808271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).