About 4-iodo-7-methoxy-1,2-benzoxazol-3-amine
4-iodo-7-methoxy-1,2-benzoxazol-3-amine (PubChem CID 24808321) has the molecular formula C8H7IN2O2
and a molecular weight of 290.06 g/mol. Its IUPAC name is 4-iodo-7-methoxy-1,2-benzoxazol-3-amine.
Molecular Properties
| Compound Name | 4-iodo-7-methoxy-1,2-benzoxazol-3-amine |
| PubChem CID | 24808321 |
| Molecular Formula | C8H7IN2O2 |
| Molecular Weight | 290.06 g/mol |
| Exact Mass | 289.96 |
| IUPAC Name | 4-iodo-7-methoxy-1,2-benzoxazol-3-amine |
| SMILES | COc1ccc(I)c2c(N)noc12 |
| InChI | InChI=1S/C8H7IN2O2/c1-12-5-3-2-4(9)6-7(5)13-11-8(6)10/h2-3H,1H3,(H2,10,11) |
| InChIKey | MUMKVCIBINNZTH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.06 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-7-methoxy-1,2-benzoxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-7-methoxy-1,2-benzoxazol-3-amine?
The IUPAC name of 4-iodo-7-methoxy-1,2-benzoxazol-3-amine (CID 24808321) is 4-iodo-7-methoxy-1,2-benzoxazol-3-amine.
What is the SMILES notation for 4-iodo-7-methoxy-1,2-benzoxazol-3-amine?
The canonical SMILES for 4-iodo-7-methoxy-1,2-benzoxazol-3-amine is COc1ccc(I)c2c(N)noc12.
What is the InChIKey of 4-iodo-7-methoxy-1,2-benzoxazol-3-amine?
The InChIKey is MUMKVCIBINNZTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7IN2O2/c1-12-5-3-2-4(9)6-7(5)13-11-8(6)10/h2-3H,1H3,(H2,10,11).
What are the key properties of 4-iodo-7-methoxy-1,2-benzoxazol-3-amine?
4-iodo-7-methoxy-1,2-benzoxazol-3-amine has a molecular weight of 290.06 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-7-methoxy-1,2-benzoxazol-3-amine is sourced from PubChem (CID 24808321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).