C27H28F6N2O6 — CID 24808559
5-(1,3-benzodioxol-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione (PubChem CID 24808559) has the molecular formula C27H28F6N2O6 and a molecular weight of 590.52 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24808559 |
| Molecular Formula | C27H28F6N2O6 |
| Molecular Weight | 590.52 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCCCCN1C(=O)NC(C)(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C27H28F6N2O6/c1-3-6-16-13-18(25(38,26(28,29)30)27(31,32)33)8-9-19(16)39-12-5-4-11-35-22(36)24(2,34-23(35)37)17-7-10-20-21(14-17)41-15-40-20/h7-10,13-14,38H,3-6,11-12,15H2,1-2H3,(H,34,37) |
| InChIKey | RKVUYLWNCWZIKP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|