C13H17NO — CID 24808609
(NE)-N-(7-propan-2-yl-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine (PubChem CID 24808609) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is (NE)-N-(7-propan-2-yl-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(7-propan-2-yl-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 24808609 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (NE)-N-(7-propan-2-yl-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine |
| SMILES | CC(C)c1ccc2c(c1)/C(=N/O)CCC2 |
| InChI | InChI=1S/C13H17NO/c1-9(2)11-7-6-10-4-3-5-13(14-15)12(10)8-11/h6-9,15H,3-5H2,1-2H3/b14-13+ |
| InChIKey | DOKNUSYJLHSZHA-BUHFOSPRSA-N |
| XLogP | 3.32 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|