C18H41BO4Si2 — CID 24808649
[(E,5S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]hex-1-enyl]boronic acid (PubChem CID 24808649) has the molecular formula C18H41BO4Si2 and a molecular weight of 388.51 g/mol. Its IUPAC name is [(E,5S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]hex-1-enyl]boronic acid.
| Compound Name | [(E,5S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]hex-1-enyl]boronic acid |
|---|---|
| PubChem CID | 24808649 |
| Molecular Formula | C18H41BO4Si2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | [(E,5S)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]hex-1-enyl]boronic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](CC/C=C/B(O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H41BO4Si2/c1-17(2,3)24(7,8)22-15-16(13-11-12-14-19(20)21)23-25(9,10)18(4,5)6/h12,14,16,20-21H,11,13,15H2,1-10H3/b14-12+/t16-/m0/s1 |
| InChIKey | HPEYDJBVYLXJHM-GRNBYLDVSA-N |
| XLogP | 4.75 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|