C23H40OSi2 — CID 24808739
1,5-bis[tert-butyl(dimethyl)silyl]-3-(cyclohexen-1-yl)penta-1,4-diyn-3-ol (PubChem CID 24808739) has the molecular formula C23H40OSi2 and a molecular weight of 388.74 g/mol. Its IUPAC name is 1,5-bis[tert-butyl(dimethyl)silyl]-3-(cyclohexen-1-yl)penta-1,4-diyn-3-ol.
| Compound Name | 1,5-bis[tert-butyl(dimethyl)silyl]-3-(cyclohexen-1-yl)penta-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 24808739 |
| Molecular Formula | C23H40OSi2 |
| Molecular Weight | 388.74 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 1,5-bis[tert-butyl(dimethyl)silyl]-3-(cyclohexen-1-yl)penta-1,4-diyn-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)C#CC(O)(C#C[Si](C)(C)C(C)(C)C)C1=CCCCC1 |
| InChI | InChI=1S/C23H40OSi2/c1-21(2,3)25(7,8)18-16-23(24,20-14-12-11-13-15-20)17-19-26(9,10)22(4,5)6/h14,24H,11-13,15H2,1-10H3 |
| InChIKey | OFWCRTSUDFQHIY-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.74 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|