About CID 24808857
CID 24808857 (PubChem CID 24808857) has the molecular formula C22H25NO6
and a molecular weight of 399.44 g/mol.
Molecular Properties
| Compound Name | CID 24808857 |
| PubChem CID | 24808857 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | — |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@]3(COC(C)(C)O3)[C@]23CN=C(C#Cc2ccccc2)O3)O1 |
| InChI | InChI=1S/C22H25NO6/c1-19(2)25-14-22(29-19)21(18-16(12-24-22)26-20(3,4)28-18)13-23-17(27-21)11-10-15-8-6-5-7-9-15/h5-9,16,18H,12-14H2,1-4H3/t16-,18-,21+,22+/m1/s1 |
| InChIKey | KZIWIQJAGRPORK-IIPCHUTBSA-N |
| XLogP | 2.24 |
| TPSA | 67.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 24808857 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24808857?
The IUPAC name of CID 24808857 (CID 24808857) is not available.
What is the SMILES notation for CID 24808857?
The canonical SMILES for CID 24808857 is CC1(C)O[C@@H]2[C@@H](CO[C@]3(COC(C)(C)O3)[C@]23CN=C(C#Cc2ccccc2)O3)O1.
What is the InChIKey of CID 24808857?
The InChIKey is KZIWIQJAGRPORK-IIPCHUTBSA-N. The full InChI is InChI=1S/C22H25NO6/c1-19(2)25-14-22(29-19)21(18-16(12-24-22)26-20(3,4)28-18)13-23-17(27-21)11-10-15-8-6-5-7-9-15/h5-9,16,18H,12-14H2,1-4H3/t16-,18-,21+,22+/m1/s1.
What are the key properties of CID 24808857?
CID 24808857 has a molecular weight of 399.44 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24808857 is sourced from PubChem (CID 24808857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).