About [5-[1-(4-methoxyphenyl)but-3-enyl]-3,4-dihydro-2H-pyran-6-yl] trifluoromethanesulfonate
[5-[1-(4-methoxyphenyl)but-3-enyl]-3,4-dihydro-2H-pyran-6-yl] trifluoromethanesulfonate (PubChem CID 24808968) has the molecular formula C17H19F3O5S
and a molecular weight of 392.40 g/mol. Its IUPAC name is [5-[1-(4-methoxyphenyl)but-3-enyl]-3,4-dihydro-2H-pyran-6-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [5-[1-(4-methoxyphenyl)but-3-enyl]-3,4-dihydro-2H-pyran-6-yl] trifluoromethanesulfonate |
| PubChem CID | 24808968 |
| Molecular Formula | C17H19F3O5S |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | [5-[1-(4-methoxyphenyl)but-3-enyl]-3,4-dihydro-2H-pyran-6-yl] trifluoromethanesulfonate |
| SMILES | C=CCC(C1=C(OS(=O)(=O)C(F)(F)F)OCCC1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H19F3O5S/c1-3-5-14(12-7-9-13(23-2)10-8-12)15-6-4-11-24-16(15)25-26(21,22)17(18,19)20/h3,7-10,14H,1,4-6,11H2,2H3 |
| InChIKey | YVVOVGPIUNYHQQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [5-[1-(4-methoxyphenyl)but-3-enyl]-3,4-dihydro-2H-pyran-6-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[1-(4-methoxyphenyl)but-3-enyl]-3,4-dihydro-2H-pyran-6-yl] trifluoromethanesulfonate?
The IUPAC name of [5-[1-(4-methoxyphenyl)but-3-enyl]-3,4-dihydro-2H-pyran-6-yl] trifluoromethanesulfonate (CID 24808968) is [5-[1-(4-methoxyphenyl)but-3-enyl]-3,4-dihydro-2H-pyran-6-yl] trifluoromethanesulfonate.
What is the SMILES notation for [5-[1-(4-methoxyphenyl)but-3-enyl]-3,4-dihydro-2H-pyran-6-yl] trifluoromethanesulfonate?
The canonical SMILES for [5-[1-(4-methoxyphenyl)but-3-enyl]-3,4-dihydro-2H-pyran-6-yl] trifluoromethanesulfonate is C=CCC(C1=C(OS(=O)(=O)C(F)(F)F)OCCC1)c1ccc(OC)cc1.
What is the InChIKey of [5-[1-(4-methoxyphenyl)but-3-enyl]-3,4-dihydro-2H-pyran-6-yl] trifluoromethanesulfonate?
The InChIKey is YVVOVGPIUNYHQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F3O5S/c1-3-5-14(12-7-9-13(23-2)10-8-12)15-6-4-11-24-16(15)25-26(21,22)17(18,19)20/h3,7-10,14H,1,4-6,11H2,2H3.
What are the key properties of [5-[1-(4-methoxyphenyl)but-3-enyl]-3,4-dihydro-2H-pyran-6-yl] trifluoromethanesulfonate?
[5-[1-(4-methoxyphenyl)but-3-enyl]-3,4-dihydro-2H-pyran-6-yl] trifluoromethanesulfonate has a molecular weight of 392.40 g/mol, XLogP of 4.24, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[1-(4-methoxyphenyl)but-3-enyl]-3,4-dihydro-2H-pyran-6-yl] trifluoromethanesulfonate is sourced from PubChem (CID 24808968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).