About bis(2-amino-4,6-ditert-butylphenolate);cobalt(2+)
bis(2-amino-4,6-ditert-butylphenolate);cobalt(2+) (PubChem CID 24809192) has the molecular formula C28H44CoN2O2
and a molecular weight of 499.61 g/mol. Its IUPAC name is bis(2-amino-4,6-ditert-butylphenolate);cobalt(2+).
Molecular Properties
| Compound Name | bis(2-amino-4,6-ditert-butylphenolate);cobalt(2+) |
| PubChem CID | 24809192 |
| Molecular Formula | C28H44CoN2O2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | bis(2-amino-4,6-ditert-butylphenolate);cobalt(2+) |
| SMILES | CC(C)(C)c1cc(N)c([O-])c(C(C)(C)C)c1.CC(C)(C)c1cc(N)c([O-])c(C(C)(C)C)c1.[Co+2] |
| InChI | InChI=1S/2C14H23NO.Co/c2*1-13(2,3)9-7-10(14(4,5)6)12(16)11(15)8-9;/h2*7-8,16H,15H2,1-6H3;/q;;+2/p-2 |
| InChIKey | MSMUPAISEWRJOF-UHFFFAOYSA-L |
| XLogP | 5.87 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze bis(2-amino-4,6-ditert-butylphenolate);cobalt(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-amino-4,6-ditert-butylphenolate);cobalt(2+)?
The IUPAC name of bis(2-amino-4,6-ditert-butylphenolate);cobalt(2+) (CID 24809192) is bis(2-amino-4,6-ditert-butylphenolate);cobalt(2+).
What is the SMILES notation for bis(2-amino-4,6-ditert-butylphenolate);cobalt(2+)?
The canonical SMILES for bis(2-amino-4,6-ditert-butylphenolate);cobalt(2+) is CC(C)(C)c1cc(N)c([O-])c(C(C)(C)C)c1.CC(C)(C)c1cc(N)c([O-])c(C(C)(C)C)c1.[Co+2].
What is the InChIKey of bis(2-amino-4,6-ditert-butylphenolate);cobalt(2+)?
The InChIKey is MSMUPAISEWRJOF-UHFFFAOYSA-L. The full InChI is InChI=1S/2C14H23NO.Co/c2*1-13(2,3)9-7-10(14(4,5)6)12(16)11(15)8-9;/h2*7-8,16H,15H2,1-6H3;/q;;+2/p-2.
What are the key properties of bis(2-amino-4,6-ditert-butylphenolate);cobalt(2+)?
bis(2-amino-4,6-ditert-butylphenolate);cobalt(2+) has a molecular weight of 499.61 g/mol, XLogP of 5.87, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-amino-4,6-ditert-butylphenolate);cobalt(2+) is sourced from PubChem (CID 24809192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).