C13H11N5OS — CID 24809901
5-(2-aminopyrimidin-4-yl)-2-thiophen-3-yl-1H-pyrrole-3-carboxamide (PubChem CID 24809901) has the molecular formula C13H11N5OS and a molecular weight of 285.33 g/mol. Its IUPAC name is 5-(2-aminopyrimidin-4-yl)-2-thiophen-3-yl-1H-pyrrole-3-carboxamide.
| Compound Name | 5-(2-aminopyrimidin-4-yl)-2-thiophen-3-yl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 24809901 |
| Molecular Formula | C13H11N5OS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 5-(2-aminopyrimidin-4-yl)-2-thiophen-3-yl-1H-pyrrole-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccnc(N)n2)[nH]c1-c1ccsc1 |
| InChI | InChI=1S/C13H11N5OS/c14-12(19)8-5-10(9-1-3-16-13(15)18-9)17-11(8)7-2-4-20-6-7/h1-6,17H,(H2,14,19)(H2,15,16,18) |
| InChIKey | GIEWZQNAONSKKX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |