About 2-(4-methylphenyl)-1,3-dihydroisoindol-5-amine
2-(4-methylphenyl)-1,3-dihydroisoindol-5-amine (PubChem CID 24810857) has the molecular formula C15H16N2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1,3-dihydroisoindol-5-amine.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)-1,3-dihydroisoindol-5-amine |
| PubChem CID | 24810857 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-(4-methylphenyl)-1,3-dihydroisoindol-5-amine |
| SMILES | Cc1ccc(N2Cc3ccc(N)cc3C2)cc1 |
| InChI | InChI=1S/C15H16N2/c1-11-2-6-15(7-3-11)17-9-12-4-5-14(16)8-13(12)10-17/h2-8H,9-10,16H2,1H3 |
| InChIKey | XFGBTMSHWJENHY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methylphenyl)-1,3-dihydroisoindol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)-1,3-dihydroisoindol-5-amine?
The IUPAC name of 2-(4-methylphenyl)-1,3-dihydroisoindol-5-amine (CID 24810857) is 2-(4-methylphenyl)-1,3-dihydroisoindol-5-amine.
What is the SMILES notation for 2-(4-methylphenyl)-1,3-dihydroisoindol-5-amine?
The canonical SMILES for 2-(4-methylphenyl)-1,3-dihydroisoindol-5-amine is Cc1ccc(N2Cc3ccc(N)cc3C2)cc1.
What is the InChIKey of 2-(4-methylphenyl)-1,3-dihydroisoindol-5-amine?
The InChIKey is XFGBTMSHWJENHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2/c1-11-2-6-15(7-3-11)17-9-12-4-5-14(16)8-13(12)10-17/h2-8H,9-10,16H2,1H3.
What are the key properties of 2-(4-methylphenyl)-1,3-dihydroisoindol-5-amine?
2-(4-methylphenyl)-1,3-dihydroisoindol-5-amine has a molecular weight of 224.31 g/mol, XLogP of 3.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)-1,3-dihydroisoindol-5-amine is sourced from PubChem (CID 24810857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).