C19H25FN4O — CID 24811530
[4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone (PubChem CID 24811530) has the molecular formula C19H25FN4O and a molecular weight of 344.43 g/mol. Its IUPAC name is [4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone.
| Compound Name | [4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 24811530 |
| Molecular Formula | C19H25FN4O |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [4-[2-(4-fluorophenyl)ethyl]piperazin-1-yl]-(5-propan-2-yl-1H-pyrazol-3-yl)methanone |
| SMILES | CC(C)c1cc(C(=O)N2CCN(CCc3ccc(F)cc3)CC2)n[nH]1 |
| InChI | InChI=1S/C19H25FN4O/c1-14(2)17-13-18(22-21-17)19(25)24-11-9-23(10-12-24)8-7-15-3-5-16(20)6-4-15/h3-6,13-14H,7-12H2,1-2H3,(H,21,22) |
| InChIKey | DFWVUMMCYMROEO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |