C17H18N4O2 — CID 24811902
(E)-3-[3-(6-piperazin-1-ylpyrazin-2-yl)phenyl]prop-2-enoic acid (PubChem CID 24811902) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is (E)-3-[3-(6-piperazin-1-ylpyrazin-2-yl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(6-piperazin-1-ylpyrazin-2-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 24811902 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (E)-3-[3-(6-piperazin-1-ylpyrazin-2-yl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(-c2cncc(N3CCNCC3)n2)c1 |
| InChI | InChI=1S/C17H18N4O2/c22-17(23)5-4-13-2-1-3-14(10-13)15-11-19-12-16(20-15)21-8-6-18-7-9-21/h1-5,10-12,18H,6-9H2,(H,22,23)/b5-4+ |
| InChIKey | FODQNTDRJCXQQJ-SNAWJCMRSA-N |
| XLogP | 1.65 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|