C14H20F3N5 — CID 24812050
N-octan-3-yl-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 24812050) has the molecular formula C14H20F3N5 and a molecular weight of 315.34 g/mol. Its IUPAC name is N-octan-3-yl-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-octan-3-yl-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 24812050 |
| Molecular Formula | C14H20F3N5 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-octan-3-yl-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCCCCC(CC)Nc1cc(C(F)(F)F)nc2ncnn12 |
| InChI | InChI=1S/C14H20F3N5/c1-3-5-6-7-10(4-2)20-12-8-11(14(15,16)17)21-13-18-9-19-22(12)13/h8-10,20H,3-7H2,1-2H3 |
| InChIKey | QFYOCDONAVKECZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|