C18H32NO5P — CID 24812110
[2-amino-1-hydroxy-4-(4-octylphenyl)butan-2-yl] dihydrogen phosphate (PubChem CID 24812110) has the molecular formula C18H32NO5P and a molecular weight of 373.43 g/mol. Its IUPAC name is [2-amino-1-hydroxy-4-(4-octylphenyl)butan-2-yl] dihydrogen phosphate.
| Compound Name | [2-amino-1-hydroxy-4-(4-octylphenyl)butan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 24812110 |
| Molecular Formula | C18H32NO5P |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | [2-amino-1-hydroxy-4-(4-octylphenyl)butan-2-yl] dihydrogen phosphate |
| SMILES | CCCCCCCCc1ccc(CCC(N)(CO)OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C18H32NO5P/c1-2-3-4-5-6-7-8-16-9-11-17(12-10-16)13-14-18(19,15-20)24-25(21,22)23/h9-12,20H,2-8,13-15,19H2,1H3,(H2,21,22,23) |
| InChIKey | KLULNXUHMWEEKT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|